(25R)-17-Hydroxyspirost-5-en-3-yl 2-O-[(1R,2R,3R,4S,5R)-2,3,4-trihydroxy-5-methylcyclohexyl]-beta-D-glucopyranoside
CAS Number: 55916-51-3
Structure Viewer
Loading molecule structure...
Open the 3D tab to load the molecule viewer
C[C@H]([C@@]1(O[C@H]2C[C@@H]3[C@]4(C)CC[C@@H]5[C@@](C)(CCC(C6)O[C@@H]([C@@H]([C@H]7O)O[C@H](C[C@@H](C)[C@@H]([C@H]8O)O)[C@@H]8O)O[C@H](CO)[C@H]7O)C6=CC[C@@H]35)OC[C@H](C)CC1)[C@]24O
Molecule Information
Mutagenic: none Tumorigenic: none Irritant: none
Formula
C40H64O12
Molecular Weight
736.936
Drug-likeness
0.63022
CAS
55916-51-3
InChI key
MSOCRRNEUZGEBR-CBLXBRAPSA-N
SMILES
C[C@H]([C@@]1(O[C@H]2C[C@@H]3[C@]4(C)CC[C@@H]5[C@@](C)(CCC(C6)O[C@@H]([C@@H]([C@H]7O)O[C@H](C[C@@H](C)[C@@H]([C@H]8O)O)[C@@H]8O)O[C@H](CO)[C@H]7O)C6=CC[C@@H]35)OC[C@H](C)CC1)[C@]24O
ChemrytIQ
CAS Information Snapshot
Mutagenic
none
Tumorigenic
none
Handling Watch
Irritant: none | Reproductive effective: low
| Property | Value |
| CAS Number | 55916-51-3 |
| Molecule Name | (25R)-17-Hydroxyspirost-5-en-3-yl 2-O-[(1R,2R,3R,4S,5R)-2,3,4-trihydroxy-5-methylcyclohexyl]-beta-D-glucopyranoside |
| Molecular Formula | C40H64O12 |
| SMILES | C[C@H]([C@@]1(O[C@H]2C[C@@H]3[C@]4(C)CC[C@@H]5[C@@](C)(CCC(C6)O[C@@H]([C@@H]([C@H]7O)O[C@H](C[C@@H](C)[C@@H]([C@H]8O)O)[C@@H]8O)O[C@H](CO)[C@H]7O)C6=CC[C@@H]35)OC[C@H](C)CC1)[C@]24O |
| InChI | InChI=1S/C40H64O12/c1-19-8-13-39(48-18-19)21(3)40(47)29(52-39)16-26-24-7-6-22-15-23(9-11-37(22,4)25(24)10-12-38(26,40)5)49-36-35(34(46)32(44)28(17-41)51-36)50-27-14-20(2)30(42)33(45)31(27)43/h6,19-21,23-36,41-47H,7-18H2,1-5H3/t19-,20-,21+,23?,24-,25+,26-, |
| InChI Key | MSOCRRNEUZGEBR-CBLXBRAPSA-N |
| CanonicalSyTyLFy | a1091aec12f78479 |
| TotalMolweight | 736.936 |
| Molecular Weight | 736.936 |
| MonoisotopicMass | 736.43978 |
| CLogP | 1.9175 |
| CLogS | -5.494 |
| H Acceptors | 12 |
| H Donors | 7 |
| TotalSurfaceArea | 505.22 |
| Relative PSA | 0.28047 |
| PolarSurfaceArea | 187.76 |
| Drug-likeness | 0.63022 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Shape Index | 0.46154 |
| Molecula Flexibility | 0.23206 |
| Molecular Complexity | 1.0892 |
| Fragments | 1 |
| Non HAtoms | 52 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| StereoCenters | 21 |
| Rotatable Bond | 5 |
| Rings Closures | 8 |
| Small Rings | 8 |
| Sp3Atoms | 50 |
| StereoCon | unknown chirality |
Related CAS
Randomized CAS records for additional exploration.
| CAS Number | Mutagenic | Tumorigenic | Irritant | Molecule Formula | Mol Weight | Druglikeness | ChemrytIQ |
| 100-00-5 | none | none | none | C6H4NO2Cl | 157.556 | -7.4592 | ChemrytIQ |
| 100-17-4 | none | none | none | C7H7NO3 | 153.137 | -7.2945 | ChemrytIQ |
| 1000018-50-7 | none | none | none | C13H16N2O4 | 264.28 | -7.3568 | ChemrytIQ |
| 100005-68-3 | none | none | none | C13H12O4 | 232.234 | -4.9451 | ChemrytIQ |
| 100-41-4 | high | high | high | C8H10 | 106.167 | -2.68 | ChemrytIQ |
| 100023-32-3 | high | high | none | CH3O4S.C20H19N2O | 303.384 | 0.7545 | ChemrytIQ |
| 100-05-0 | none | none | none | Cl.C6H4N3O2 | 150.117 | -9.1371 | ChemrytIQ |
| 1000339-32-1 | none | none | none | C11H14NF | 179.237 | 0.6275 | ChemrytIQ |
| 100-29-8 | none | none | none | C8H9NO3 | 167.163 | -8.928 | ChemrytIQ |
| 100010-99-9 | none | none | none | C11H24O2 | 188.31 | -23.185 | ChemrytIQ |
| 100-73-2 | high | none | none | C6H8O2 | 112.128 | -6.3422 | ChemrytIQ |
| 100027-90-5 | high | high | none | C20H26N2Cl2.HCl.HCl | 365.346 | 4.1664 | ChemrytIQ |
| 100-95-8 | none | none | none | Cl.C23H41N2O | 361.592 | -17.647 | ChemrytIQ |
| 100009-01-6 | none | none | none | C15H13N3O3 | 283.286 | -2.3895 | ChemrytIQ |
| 10-18-2004 | none | none | none | C6H8OS2 | 160.261 | -3.1913 | ChemrytIQ |
| 1000018-10-9 | none | none | none | C7H8N2OBr2 | 295.962 | -5.2121 | ChemrytIQ |
| 100-50-5 | none | none | high | C7H10O | 110.155 | -9.6048 | ChemrytIQ |
| 1000018-39-2 | high | high | low | C13H20N2O2S | 268.38 | 1.9315 | ChemrytIQ |
| 1000296-70-7 | none | none | none | C19H27NO7S3 | 477.621 | 3.1322 | ChemrytIQ |
| 1000018-26-7 | none | none | none | C16H23NO3 | 277.363 | -15.052 | ChemrytIQ |
| 1000018-40-5 | low | high | none | C11H16N2O2S | 240.326 | 1.4856 | ChemrytIQ |
| 100-23-2 | none | high | none | C8H10N2O2 | 166.179 | -5.0759 | ChemrytIQ |
| 100-92-5 | none | none | none | C11H17N | 163.263 | 1.1672 | ChemrytIQ |
| 100-09-4 | none | none | none | C8H8O3 | 152.149 | -1.597 | ChemrytIQ |
| 1000018-56-3 | none | none | none | C7H4N3O2Br | 242.032 | -0.39052 | ChemrytIQ |
| 1000025-93-3 | none | none | none | C20H17NO4 | 335.358 | -1.6731 | ChemrytIQ |
| 100-44-7 | high | high | none | C7H7Cl | 126.586 | -2.365 | ChemrytIQ |
| 100-19-6 | none | none | none | C8H7NO3 | 165.148 | -7.0365 | ChemrytIQ |
| 1000120-98-8 | high | none | high | C230H305N67O122P19S19 | 7158.06 | -20.81 | ChemrytIQ |
| 100-99-2 | none | none | low | C12H27Al | 198.328 | -22.009 | ChemrytIQ |
| 1000025-92-2 | none | none | none | C20H16N2O2 | 316.359 | -6.3825 | ChemrytIQ |
| 1000-57-3 | high | none | low | C6H16SSn | 238.969 | -7.4261 | ChemrytIQ |
| 100-02-7 | none | none | none | C6H5NO3 | 139.11 | -7.5665 | ChemrytIQ |
| 100003-81-4 | high | high | none | C8H7N2OClS | 214.676 | 1.4208 | ChemrytIQ |
| 100007-67-8 | high | none | low | C5H7OClF2 | 156.559 | -12.702 | ChemrytIQ |
| 100008-84-2 | none | none | none | C22H14N2O2 | 338.365 | 3.1859 | ChemrytIQ |
| 1000-87-9 | none | none | none | C7H12 | 96.1723 | -2.6557 | ChemrytIQ |
| 100-52-7 | high | high | high | C7H6O | 106.124 | -4.225 | ChemrytIQ |
| 1000-86-8 | none | none | none | C7H12 | 96.1723 | -10.397 | ChemrytIQ |
| 100-25-4 | none | none | none | C6H4N2O4 | 168.108 | -7.74 | ChemrytIQ |
| 100004-54-4 | none | high | none | C4H8Te | 183.708 | -3.9699 | ChemrytIQ |
| 10003-94-8 | none | none | none | C9H16N2O18P4 | 564.118 | -31.509 | ChemrytIQ |
| 100-67-4 | none | none | none | K.C6H5O | 93.1047 | -2.2548 | ChemrytIQ |
| 1000025-59-1 | none | none | none | C14H11O3Cl | 262.691 | -1.449 | ChemrytIQ |
| 100-90-3 | none | none | none | C14H16N4O3S | 320.372 | 4.7301 | ChemrytIQ |
| 100-39-0 | high | high | none | C7H7Br | 171.037 | -7.8241 | ChemrytIQ |
| 100-77-6 | none | none | none | C6H4N2Cl.Cl | 139.565 | -4.1248 | ChemrytIQ |
| 100-74-3 | high | none | high | C6H13NO | 115.175 | 3.7593 | ChemrytIQ |
| 100-57-2 | high | low | low | C6H6OHg | 294.703 | -2.3891 | ChemrytIQ |
| 1000018-58-5 | none | none | none | C6H4NBr2Cl | 285.366 | -3.6 | ChemrytIQ |
| 1000068-42-7 | none | none | none | C10H11NO3BrFS | 324.169 | -2.2263 | ChemrytIQ |
| 1000339-33-2 | none | none | none | C10H11NClF | 199.655 | 0.76 | ChemrytIQ |
| 1000269-67-9 | none | none | none | C13H22N4 | 234.346 | 0.99367 | ChemrytIQ |
| 10000-51-8 | none | none | none | C14H15NO3 | 245.277 | 0.10503 | ChemrytIQ |
| 100021-47-4 | none | none | none | C13H17N5O6 | 339.307 | -2.7249 | ChemrytIQ |
| 1000-84-6 | none | none | high | C4H9NO | 87.1215 | -6.3779 | ChemrytIQ |
| 10001-46-4 | none | none | none | C9H11N3O3 | 209.204 | 1.9565 | ChemrytIQ |
| 1000-00-6 | none | none | high | C10H26OSi2 | 218.487 | -62.76 | ChemrytIQ |
| 1000-90-4 | none | none | none | Zn.C4H7OS2.C4H7OS2 | 135.231 | -2.7683 | ChemrytIQ |
| 1000166-63-1 | none | high | none | C20H23N8O2Br | 487.361 | -0.90793 | ChemrytIQ |