N-[4-Methoxy-3-(trimethylazaniumyl)phenyl]-2-{2-[4-({4-[(1-{[4-methoxy-3-(trimethylazaniumyl)phenyl]carboximidato}-2-oxopropyl)diazenyl]benzoyl}imino)cyclohexa-2,5-dien-1-ylidene]hydrazinyl}-3-oxobuta<NL>nimidate--hydrogen chloride (1/2)
CAS Number: 90441-31-9
Structure Viewer
Loading molecule structure...
Open the 3D tab to load the molecule viewer
CC(C(/C(/[O-])=N/c(cc1)cc([N+](C)(C)C)c1OC)N/N=C(\C=C1)/C=C/C1=N\C(c(cc1)ccc1/N=N/C(C(C)=O)/C(/[O-])=N/c(cc1)cc([N+](C)(C)C)c1OC)=O)=O.Cl.Cl
Molecule Information
Mutagenic: low Tumorigenic: high Irritant: none
Formula
HCl.HCl.C41H47N9O7
Molecular Weight
777.88
Drug-likeness
-4.1679
CAS
90441-31-9
InChI key
QEJVLBPZMJAGEF-YPWDGYECSA-N
SMILES
CC(C(/C(/[O-])=N/c(cc1)cc([N+](C)(C)C)c1OC)N/N=C(\C=C1)/C=C/C1=N\C(c(cc1)ccc1/N=N/C(C(C)=O)/C(/[O-])=N/c(cc1)cc([N+](C)(C)C)c1OC)=O)=O.Cl.Cl
ChemrytIQ
CAS Information Snapshot
Mutagenic
low
Tumorigenic
high
Handling Watch
Irritant: none | Reproductive effective: high
| Property | Value |
| CAS Number | 90441-31-9 |
| Molecule Name | N-[4-Methoxy-3-(trimethylazaniumyl)phenyl]-2-{2-[4-({4-[(1-{[4-methoxy-3-(trimethylazaniumyl)phenyl]carboximidato}-2-oxopropyl)diazenyl]benzoyl}imino)cyclohexa-2,5-dien-1-ylidene]hydrazinyl}-3-oxobuta<NL>nimidate--hydrogen chloride (1/2) |
| Molecular Formula | HCl.HCl.C41H47N9O7 |
| SMILES | CC(C(/C(/[O-])=N/c(cc1)cc([N+](C)(C)C)c1OC)N/N=C(\C=C1)/C=C/C1=N\C(c(cc1)ccc1/N=N/C(C(C)=O)/C(/[O-])=N/c(cc1)cc([N+](C)(C)C)c1OC)=O)=O.Cl.Cl |
| InChI | InChI=1S/C41H47N9O7.2ClH/c1-25(51)37(40(54)43-31-19-21-35(56-9)33(23-31)49(3,4)5)47-45-29-13-11-27(12-14-29)39(53)42-28-15-17-30(18-16-28)46-48-38(26(2)52)41(55)44-32-20-22-36(57-10)34(24-32)50(6,7)8;;/h11-24,37-38H,1-10H3,(H-2,42,43,44,48,53,54,55);2*1H/ |
| InChI Key | QEJVLBPZMJAGEF-YPWDGYECSA-N |
| CanonicalSyTyLFy | d279dddd29901c47 |
| TotalMolweight | 850.802 |
| Molecular Weight | 777.88 |
| MonoisotopicMass | 777.359846 |
| CLogP | -11.67 |
| CLogS | -5.992 |
| H Acceptors | 16 |
| H Donors | 1 |
| TotalSurfaceArea | 606.31 |
| Relative PSA | 0.25228 |
| PolarSurfaceArea | 201.98 |
| Drug-likeness | -4.1679 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | quart. ammonium; azo |
| Shape Index | 0.5614 |
| Molecula Flexibility | 0.48818 |
| Molecular Complexity | 0.88077 |
| Fragments | 3 |
| Non HAtoms | 57 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| StereoCenters | 2 |
| Rotatable Bond | 15 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 18 |
| Symmetricatoms | 8 |
| Amines | 2 |
| Aromatic Amines | 2 |
| BasicNitrogens | 1 |
| StereoCon | unknown chirality |
Related CAS
Randomized CAS records for additional exploration.
| CAS Number | Mutagenic | Tumorigenic | Irritant | Molecule Formula | Mol Weight | Druglikeness | ChemrytIQ |
| 100019-64-5 | none | none | none | C9H10N2O7FP | 308.157 | -34.083 | ChemrytIQ |
| 1000-56-2 | none | none | none | C3H7O4S.Na | 139.151 | -6.9141 | ChemrytIQ |
| 100028-43-1 | none | none | none | Br.C21H35N2 | 315.523 | -2.5218 | ChemrytIQ |
| 1000017-98-0 | none | none | none | C8H4N2O2BrCl | 275.489 | -2.5326 | ChemrytIQ |
| 100021-47-4 | none | none | none | C13H17N5O6 | 339.307 | -2.7249 | ChemrytIQ |
| 100-28-7 | high | low | low | C7H4N2O3 | 164.12 | -21.552 | ChemrytIQ |
| 1000171-05-0 | none | none | none | C27H37O3P | 440.562 | -24.592 | ChemrytIQ |
| 1000018-44-9 | none | none | none | C13H16N2O5 | 280.279 | -2.3885 | ChemrytIQ |
| 100-54-9 | none | none | none | C6H4N2 | 104.112 | -6.0498 | ChemrytIQ |
| 100033-59-8 | none | none | none | C8H16N2 | 140.229 | 0.9406 | ChemrytIQ |
| 100005-68-3 | none | none | none | C13H12O4 | 232.234 | -4.9451 | ChemrytIQ |
| 10001-52-2 | high | high | none | C11H10N6O3S | 306.305 | 6.7202 | ChemrytIQ |
| 100-07-2 | high | high | low | C8H7O2Cl | 170.595 | -10.49 | ChemrytIQ |
| 100-11-8 | low | high | none | C7H6NO2Br | 216.034 | -13.162 | ChemrytIQ |
| 1000018-50-7 | none | none | none | C13H16N2O4 | 264.28 | -7.3568 | ChemrytIQ |
| 1000018-25-6 | none | none | none | C13H24N2O6S | 336.408 | -32.405 | ChemrytIQ |
| 100012-49-5 | none | none | none | C10H2O4Br4 | 505.738 | -8.4981 | ChemrytIQ |
| 1000-78-8 | high | low | none | C11H24N2 | 184.326 | -10.254 | ChemrytIQ |
| 100-19-6 | none | none | none | C8H7NO3 | 165.148 | -7.0365 | ChemrytIQ |
| 100-00-5 | none | none | none | C6H4NO2Cl | 157.556 | -7.4592 | ChemrytIQ |
| 100001-06-7 | none | none | none | I.C20H28NO | 298.448 | -2.3411 | ChemrytIQ |
| 1000339-54-7 | none | none | none | C9H7O2F3 | 204.147 | -11.176 | ChemrytIQ |
| 1000-58-4 | high | high | high | C4H8Cl4Si | 226.006 | -54.611 | ChemrytIQ |
| 100013-07-8 | none | none | none | C18H32B.Li | 259.263 | -11.013 | ChemrytIQ |
| 100-04-9 | none | high | none | Cl.C8H10N3 | 148.188 | -2.0275 | ChemrytIQ |
| 100003-81-4 | high | high | none | C8H7N2OClS | 214.676 | 1.4208 | ChemrytIQ |
| 1000339-45-6 | none | none | high | C8H14O2F2 | 180.193 | -28.199 | ChemrytIQ |
| 100017-22-9 | high | high | high | C5H8O2 | 100.117 | -8.1063 | ChemrytIQ |
| 1000-83-5 | low | high | high | C2H6N2OS | 106.149 | -2.264 | ChemrytIQ |
| 1000-69-7 | high | none | low | C7H18SSn | 252.996 | -9.6969 | ChemrytIQ |
| 100-65-2 | high | none | none | C6H7NO | 109.128 | -1.548 | ChemrytIQ |
| 100-26-5 | none | none | none | C7H5NO4 | 167.12 | -1.5746 | ChemrytIQ |
| 100019-40-7 | none | none | none | C14H15NO3 | 245.277 | -1.947 | ChemrytIQ |
| 10003-42-6 | none | none | none | C11H11NO4 | 221.211 | -4.7046 | ChemrytIQ |
| 1000068-23-4 | none | low | none | C14H18NO5B | 291.11 | -44.603 | ChemrytIQ |
| 1000339-36-5 | none | none | none | C16H19NO3S | 305.397 | -3.4866 | ChemrytIQ |
| 1000335-27-2 | none | none | none | C10H15N4OCl | 242.709 | 0.81574 | ChemrytIQ |
| 1000-41-5 | none | none | low | C10H18O | 154.252 | -9.05 | ChemrytIQ |
| 1000-46-0 | none | none | none | C7H18Ge | 174.83 | -4.6976 | ChemrytIQ |
| 100-76-5 | none | none | high | C7H13N | 111.187 | 3.5517 | ChemrytIQ |
| 1000018-06-3 | none | none | none | C8H8N3Br | 226.077 | 0.34749 | ChemrytIQ |
| 1000068-42-7 | none | none | none | C10H11NO3BrFS | 324.169 | -2.2263 | ChemrytIQ |
| 1000018-56-3 | none | none | none | C7H4N3O2Br | 242.032 | -0.39052 | ChemrytIQ |
| 100021-05-4 | none | none | none | C21H28O2 | 312.451 | 0.95307 | ChemrytIQ |
| 10003-69-7 | none | none | none | C10H14O8S4 | 390.477 | 0.2775 | ChemrytIQ |
| 1000339-31-0 | none | none | high | C12H16NCl | 209.719 | 0.65299 | ChemrytIQ |
| 100007-67-8 | high | none | low | C5H7OClF2 | 156.559 | -12.702 | ChemrytIQ |
| 10000-42-7 | high | high | low | C20H18N4O3 | 362.388 | -5.7793 | ChemrytIQ |
| 100031-88-7 | none | none | high | C10H30O3Si4 | 310.689 | -53.619 | ChemrytIQ |
| 1000339-51-4 | none | none | none | C7H4NO4F | 185.11 | -8.2861 | ChemrytIQ |
| 100021-85-0 | none | high | high | H3O4P.C16H32O2.C2H8N2 | 256.428 | -25.216 | ChemrytIQ |
| 100-68-5 | none | none | none | C7H8S | 124.207 | -1.735 | ChemrytIQ |
| 10001-43-1 | none | none | none | C15H18N6O2 | 314.348 | 4.1828 | ChemrytIQ |
| 10001-51-1 | none | none | none | C9H18N2O | 170.255 | 5.9677 | ChemrytIQ |
| 100008-90-0 | none | none | none | C12H11N3O3 | 245.237 | -1.9187 | ChemrytIQ |
| 1000018-40-5 | low | high | none | C11H16N2O2S | 240.326 | 1.4856 | ChemrytIQ |
| 1000-63-1 | none | none | high | C8H18O | 130.23 | -19.78 | ChemrytIQ |
| 1000-86-8 | none | none | none | C7H12 | 96.1723 | -10.397 | ChemrytIQ |
| 100-94-7 | none | none | none | Cl.C16H20N | 226.342 | -1.9788 | ChemrytIQ |
| 100-73-2 | high | none | none | C6H8O2 | 112.128 | -6.3422 | ChemrytIQ |