Compound 347
  CheckMol                        TMF02:r0:m0
MF=H14B4Li2O12 MW=263.23
 18 12  0  0  0               999 V2000
    0.0000   -0.0000   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2839    0.7656   -0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    2.5678    0.0353   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2721    2.2733   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2039   -5.4654   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1921   -3.9577   -0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    4.4760   -3.2039   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8846   -3.2039   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0251    0.2827   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5174    0.2945   -0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    8.7518    1.6019   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7635   -0.9894   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1251    3.6750   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8176    2.9330   -0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    3.5101    3.6986   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8058    1.4488   -0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4500    5.6539   -0.0000 Li  0  0  0  0  0  0  0  0  0  0  0  0
    5.9366   -0.4712   -0.0000 Li  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  6  8  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 12  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 14 16  1  0  0  0  0
M  CHG  1  15  -1
M  CHG  1  16  -1
M  CHG  1  17   1
M  CHG  1  18   1
M  END

2D Structure

Di-Lithium Tetraborate

₹ 0.00 0.00

Request Quote

Chemical Name - Di-Lithium Tetraborate
Mol Weight - 61.8318
Smiles - [O-]B([O-])O.OB(O)O.OB(O)O.OB(O)O.[Li+].[Li+]

Property Name	Property Value
Mol Name	Di-Lithium Tetraborate
Molweight	61.8318
Monoisotopic Mass	62.017525
Clogs	3.28
H Acceptors	3
H Donors	3
Total Surface Area	47.15
Relative Psa	0.83351
Polar Surface Area	60.69
Druglikeness	-8.4175
Mutagenic	high
Tumorigenic	high
Reproductive Effective	high
Irritant	high
Shape Index	0.75
Fragments	6
Non H Atoms	4
Non Ch Atoms	4
Electronegative Atoms	3
Sp3 Atoms	3
Symmetric Atoms	2
Smiles	[O-]B([O-])O.OB(O)O.OB(O)O.OB(O)O.[Li+].[Li+]
InChIKey	InChI=1S/3BH3O3.BHO3.2Li/c42-1(3)4;;/h32-4H;2H;;/q;;;-2;2*+1
InChI	AMUJFVCOMQMFIE-UHFFFAOYSA-N

Copyrights

The copyrights of data, design, and listing all reserved to Global Manufacturers and its associated sites.

Company profile, trade leads and products are user generated content.

Molecule Properties are generated theoretically — any objection please contact us.

Shipping

Usually delivered in 3–4 days.

Enter pincode for exact delivery dates/charges.

Credit / Debit Card Payment

We accept all major credit / debit cards for payment; you can also pay through online banking.

Cash On Delivery

If available, select Cash on Delivery (CoD) payment option while placing the order and pay in cash at the time of actual delivery. No advance payment needed.

1 — Di-Lithium Tetraborate | 2 — Di-Lithium Tetraborate