| MolName | N-[(Z)-(4-aminophenyl)methylideneamino]pyridine-4-carboxamide |
| MolecularFormula | C13H12N4O |
| Smiles | Nc1ccc(/C=N\NC(c2ccncc2)=O)cc1 |
| InChI | InChI=1S/C13H12N4O/c14-12-3-1-10(2-4-12)9-16-17-13(18)11-5-7-15-8-6-11/h1-9H,14H2,(H,17,18) |
| InChIK | AAEHLOISIGDVHC-UHFFFAOYSA-N |
| TotalMolweight | 240.265 |
| Molweight | 240.265 |
| MonoisotopicMass | 240.101111 |
| CLogP | 1.5234 |
| CLogS | -3.002 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 194.27 |
| Relative PSA | 0.32043 |
| PolarSurfaceArea | 80.37 |
| Druglikeness | 4.3905 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.72222 |
| Fragments | 1 |
| Non HAtoms | 18 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Symmetricatoms | 4 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-aminophenyl)methylideneamino]pyridine-4-carboxamide | 2 - N-[(Z)-(4-aminophenyl)methylideneamino]pyridine-4-carboxamide