| MolName | (E)-3-(furan-2-yl)-N-[2-[(2Z)-2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide |
| MolecularFormula | C14H12N4O5S |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CNC(/C=C/c2ccco2)=O)=O)s1)=O |
| InChI | InChI=1S/C14H12N4O5S/c19-12(5-3-10-2-1-7-23-10)15-9-13(20)17-16-8-11-4-6-14(24-11)18(21)22/h1-8H,9H2,(H,15,19)(H,17,20) |
| InChIK | AAWSWWRUNDECGO-UHFFFAOYSA-N |
| TotalMolweight | 348.338 |
| Molweight | 348.338 |
| MonoisotopicMass | 348.052841 |
| CLogP | 0.9378 |
| CLogS | -4.16 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 265.76 |
| Relative PSA | 0.47185 |
| PolarSurfaceArea | 157.76 |
| Druglikeness | -0.2335 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-3-(furan-2-yl)-N-[2-[(2Z)-2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide | 2 - (E)-3-(furan-2-yl)-N-[2-[(2Z)-2-[(5-nitrothiophen-2-yl)methylidene]hydrazinyl]-2-oxoethyl]prop-2-enamide