| MolName | 5-[5-[(Z)-[(4-amino-1,2,5-oxadiazole-3-carbonyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid |
| MolecularFormula | C15H10N5O5Cl |
| Smiles | Nc1nonc1C(N/N=C\c1ccc(-c(cc2)cc(C(O)=O)c2Cl)o1)=O |
| InChI | InChI=1S/C15H10ClN5O5/c16-10-3-1-7(5-9(10)15(23)24)11-4-2-8(25-11)6-18-19-14(22)12-13(17)21-26-20-12/h1-6H,(H2,17,21)(H,19,22)(H,23,24) |
| InChIK | ACEZKYRNEPSQAI-UHFFFAOYSA-N |
| TotalMolweight | 375.727 |
| Molweight | 375.727 |
| MonoisotopicMass | 375.037047 |
| CLogP | 2.471 |
| CLogS | -4.798 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 271.69 |
| Relative PSA | 0.46958 |
| PolarSurfaceArea | 156.84 |
| Druglikeness | 8.0637 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57692 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 5-[5-[(Z)-[(4-amino-1,2,5-oxadiazole-3-carbonyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid | 2 - 5-[5-[(Z)-[(4-amino-1,2,5-oxadiazole-3-carbonyl)hydrazinylidene]methyl]furan-2-yl]-2-chlorobenzoic acid