| MolName | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide |
| MolecularFormula | C13H10N4O7 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(cc2)ccc2[N+]([O-])=O)=O)o1)=O |
| InChI | InChI=1S/C13H10N4O7/c18-12(8-23-10-3-1-9(2-4-10)16(19)20)15-14-7-11-5-6-13(24-11)17(21)22/h1-7H,8H2,(H,15,18) |
| InChIK | ADHZPGWBZFTTNT-UHFFFAOYSA-N |
| TotalMolweight | 334.243 |
| Molweight | 334.243 |
| MonoisotopicMass | 334.054951 |
| CLogP | 0.4734 |
| CLogS | -4.628 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 247.78 |
| Relative PSA | 0.48818 |
| PolarSurfaceArea | 155.47 |
| Druglikeness | 3.0097 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide | 2 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-(4-nitrophenoxy)acetamide