| MolName | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C25H18N5O4ClS |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(CSC(N2c(cc3)ccc3Cl)=Nc(cccc3)c3C2=O)=O)cccc1)=O |
| InChI | InChI=1S/C25H18ClN5O4S/c26-18-11-13-19(14-12-18)30-24(33)20-8-2-3-9-21(20)28-25(30)36-16-23(32)29-27-15-5-7-17-6-1-4-10-22(17)31(34)35/h1-15H,16H2,(H,29,32) |
| InChIK | ADUONHNHWAILQR-UHFFFAOYSA-N |
| TotalMolweight | 519.968 |
| Molweight | 519.968 |
| MonoisotopicMass | 519.076802 |
| CLogP | 3.9132 |
| CLogS | -7.613 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 381.11 |
| Relative PSA | 0.29393 |
| PolarSurfaceArea | 145.25 |
| Druglikeness | 0.71523 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide | 2 - 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]acetamide