| MolName | 4-[(Z)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate |
| MolecularFormula | C15H10N5O2S |
| Smiles | [O-]C(c1ccc(/C=N\N(C(c2cnccc2)=NN2)C2=S)cc1)=O |
| InChI | InChI=1S/C15H11N5O2S/c21-14(22)11-5-3-10(4-6-11)8-17-20-13(18-19-15(20)23)12-2-1-7-16-9-12/h1-9H,(H,19,23)(H,21,22)/p-1 |
| InChIK | AEGQVJRCMGBZGG-UHFFFAOYSA-M |
| TotalMolweight | 324.343 |
| Molweight | 324.343 |
| MonoisotopicMass | 324.05552 |
| CLogP | -0.2968 |
| CLogS | -3.669 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 245.76 |
| Relative PSA | 0.42448 |
| PolarSurfaceArea | 125.1 |
| Druglikeness | 3.6216 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate | 2 - 4-[(Z)-(3-pyridin-3-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]benzoate