| MolName | (5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C17H8N2OCl2F2S2 |
| Smiles | O=C(/C(/SC1=S)=C/c(c(F)ccc2)c2Cl)N1N=Cc(c(F)ccc1)c1Cl |
| InChI | InChI=1S/C17H8Cl2F2N2OS2/c18-11-3-1-5-13(20)9(11)7-15-16(24)23(17(25)26-15)22-8-10-12(19)4-2-6-14(10)21/h1-8H |
| InChIK | AEVRAICOCQWWTI-UHFFFAOYSA-N |
| TotalMolweight | 429.298 |
| Molweight | 429.298 |
| MonoisotopicMass | 427.942313 |
| CLogP | 4.4688 |
| CLogS | -7.195 |
| H Acceptors | 3 |
| TotalSurfaceArea | 290.78 |
| Relative PSA | 0.25308 |
| PolarSurfaceArea | 90.06 |
| Druglikeness | 3.5266 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - (5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - (5Z)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one