| MolName | N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide |
| MolecularFormula | C22H18N2O4 |
| Smiles | O=C(c(cc1)cc2c1OCO2)N/N=C\c(cccc1)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c25-22(17-10-11-20-21(12-17)28-15-27-20)24-23-13-18-8-4-5-9-19(18)26-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,24,25) |
| InChIK | AFDJEDDRPWAANQ-UHFFFAOYSA-N |
| TotalMolweight | 374.395 |
| Molweight | 374.395 |
| MonoisotopicMass | 374.126658 |
| CLogP | 4.6611 |
| CLogS | -5.773 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 290.77 |
| Relative PSA | 0.22702 |
| PolarSurfaceArea | 69.15 |
| Druglikeness | 3.9573 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide | 2 - N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]-1,3-benzodioxole-5-carboxamide