| MolName | 1-phenyl-3-[(Z)-[2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea |
| MolecularFormula | C25H25N3O3 |
| Smiles | C=CCc(cccc1)c1OCCOc1c(/C=N\NC(Nc2ccccc2)=O)cccc1 |
| InChI | InChI=1S/C25H25N3O3/c1-2-10-20-11-6-8-15-23(20)30-17-18-31-24-16-9-7-12-21(24)19-26-28-25(29)27-22-13-4-3-5-14-22/h2-9,11-16,19H,1,10,17-18H2,(H2,27,28,29) |
| InChIK | AFNDNUYLIQZXHA-UHFFFAOYSA-N |
| TotalMolweight | 415.492 |
| Molweight | 415.492 |
| MonoisotopicMass | 415.189592 |
| CLogP | 5.5789 |
| CLogS | -6.217 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 344.03 |
| Relative PSA | 0.19612 |
| PolarSurfaceArea | 71.95 |
| Druglikeness | -6.2716 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64516 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-phenyl-3-[(Z)-[2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea | 2 - 1-phenyl-3-[(Z)-[2-[2-(2-prop-2-enylphenoxy)ethoxy]phenyl]methylideneamino]urea