| MolName | N-(4-phenoxyphenyl)-N'-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide |
| MolecularFormula | C32H25N3O4 |
| Smiles | O=C(C(N/N=C\c(c1ccccc1cc1)c1OCc1ccccc1)=O)Nc(cc1)ccc1Oc1ccccc1 |
| InChI | InChI=1S/C32H25N3O4/c36-31(34-25-16-18-27(19-17-25)39-26-12-5-2-6-13-26)32(37)35-33-21-29-28-14-8-7-11-24(28)15-20-30(29)38-22-23-9-3-1-4-10-23/h1-21H,22H2,(H,34,36)(H,35,37) |
| InChIK | AFQAEWVZNXZPRH-UHFFFAOYSA-N |
| TotalMolweight | 515.568 |
| Molweight | 515.568 |
| MonoisotopicMass | 515.184507 |
| CLogP | 6.082 |
| CLogS | -8.769 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 404.08 |
| Relative PSA | 0.19924 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 3.3836 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.58974 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(4-phenoxyphenyl)-N'-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide | 2 - N-(4-phenoxyphenyl)-N'-[(Z)-(2-phenylmethoxynaphthalen-1-yl)methylideneamino]oxamide