| MolName | 2-N-[(Z)-(2,6-dichloro-3-nitrophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H19N8O2Cl2F |
| Smiles | [O-][N+](c(ccc(Cl)c1/C=N\Nc2nc(N3CCCCC3)nc(Nc(cc3)ccc3F)n2)c1Cl)=O |
| InChI | InChI=1S/C21H19Cl2FN8O2/c22-16-8-9-17(32(33)34)18(23)15(16)12-25-30-20-27-19(26-14-6-4-13(24)5-7-14)28-21(29-20)31-10-2-1-3-11-31/h4-9,12H,1-3,10-11H2,(H2,26,27,28,29,30) |
| InChIK | AFSUPCDZHWCEJD-UHFFFAOYSA-N |
| TotalMolweight | 505.34 |
| Molweight | 505.34 |
| MonoisotopicMass | 504.099204 |
| CLogP | 6.5059 |
| CLogS | -8.151 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 363.2 |
| Relative PSA | 0.27894 |
| PolarSurfaceArea | 124.15 |
| Druglikeness | -3.7187 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(2,6-dichloro-3-nitrophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(2,6-dichloro-3-nitrophenyl)methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine