| MolName | (Z)-cinnolin-4-ylmethylidenehydrazine |
| MolecularFormula | C9H8N4 |
| Smiles | N/N=C\c1cnnc2ccccc12 |
| InChI | InChI=1S/C9H8N4/c10-11-5-7-6-12-13-9-4-2-1-3-8(7)9/h1-6H,10H2 |
| InChIK | AGWJRVNUOVCEPD-UHFFFAOYSA-N |
| TotalMolweight | 172.191 |
| Molweight | 172.191 |
| MonoisotopicMass | 172.074896 |
| CLogP | 1.0539 |
| CLogS | -2.648 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 138.66 |
| Relative PSA | 0.35136 |
| PolarSurfaceArea | 64.16 |
| Druglikeness | -2.3346 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 1 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-cinnolin-4-ylmethylidenehydrazine | 2 - (Z)-cinnolin-4-ylmethylidenehydrazine