| MolName | 1-cyclohexyl-3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]thiourea |
| MolecularFormula | C21H23N5S2 |
| Smiles | S=C(NC1CCCCC1)N/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C21H23N5S2/c27-21(23-17-8-3-1-4-9-17)24-22-14-16-15-26(18-10-5-2-6-11-18)25-20(16)19-12-7-13-28-19/h2,5-7,10-15,17H,1,3-4,8-9H2,(H2,23,24,27) |
| InChIK | AGYQKWFQUMQJEP-UHFFFAOYSA-N |
| TotalMolweight | 409.581 |
| Molweight | 409.581 |
| MonoisotopicMass | 409.139485 |
| CLogP | 4.3817 |
| CLogS | -5.822 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 324.87 |
| Relative PSA | 0.30975 |
| PolarSurfaceArea | 114.57 |
| Druglikeness | 0.47479 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-cyclohexyl-3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]thiourea | 2 - 1-cyclohexyl-3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]thiourea