| MolName | (2E)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one |
| MolecularFormula | C14H11N3O2S |
| Smiles | O=C(CS/C1=N/N=C\c2ccco2)N1c1ccccc1 |
| InChI | InChI=1S/C14H11N3O2S/c18-13-10-20-14(16-15-9-12-7-4-8-19-12)17(13)11-5-2-1-3-6-11/h1-9H,10H2 |
| InChIK | AHKAKXABIDTLGM-UHFFFAOYSA-N |
| TotalMolweight | 285.326 |
| Molweight | 285.326 |
| MonoisotopicMass | 285.057197 |
| CLogP | 3.5055 |
| CLogS | -4.676 |
| H Acceptors | 5 |
| TotalSurfaceArea | 216.24 |
| Relative PSA | 0.32931 |
| PolarSurfaceArea | 83.47 |
| Druglikeness | 3.9451 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - (2E)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one | 2 - (2E)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-3-phenyl-1,3-thiazolidin-4-one