| MolName | N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-benzothiazol-2-amine |
| MolecularFormula | C15H10N3O2ClS |
| Smiles | Clc1c(/C=N\Nc2nc(cccc3)c3s2)cc2OCOc2c1 |
| InChI | InChI=1S/C15H10ClN3O2S/c16-10-6-13-12(20-8-21-13)5-9(10)7-17-19-15-18-11-3-1-2-4-14(11)22-15/h1-7H,8H2,(H,18,19) |
| InChIK | AHKZATBDWCTLEE-UHFFFAOYSA-N |
| TotalMolweight | 331.782 |
| Molweight | 331.782 |
| MonoisotopicMass | 331.018224 |
| CLogP | 6.3607 |
| CLogS | -5.563 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 234.22 |
| Relative PSA | 0.31722 |
| PolarSurfaceArea | 83.98 |
| Druglikeness | 2.3169 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-benzothiazol-2-amine | 2 - N-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-1,3-benzothiazol-2-amine