| MolName | 1-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]thiourea |
| MolecularFormula | C16H15N3O3Cl2S2 |
| Smiles | O=S(CC1)(C[C@@H]1NC(N/N=C\c1ccc(-c(ccc(Cl)c2)c2Cl)o1)=S)=O |
| InChI | InChI=1S/C16H15Cl2N3O3S2/c17-10-1-3-13(14(18)7-10)15-4-2-12(24-15)8-19-21-16(25)20-11-5-6-26(22,23)9-11/h1-4,7-8,11H,5-6,9H2,(H2,20,21,25)/t11-/m1/s1 |
| InChIK | AHOAKRHQEUBTFT-LLVKDONJSA-N |
| TotalMolweight | 432.351 |
| Molweight | 432.351 |
| MonoisotopicMass | 430.993186 |
| CLogP | 3.3981 |
| CLogS | -6.29 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 302.8 |
| Relative PSA | 0.34716 |
| PolarSurfaceArea | 124.17 |
| Druglikeness | 3.7808 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| StereoCenters | 1 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 1-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]thiourea | 2 - 1-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]thiourea