| MolName | [2,4-dibromo-6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| MolecularFormula | C22H14N2O4Br2ClF |
| Smiles | O=C(COc(cccc1)c1Cl)N/N=C\c1cc(Br)cc(Br)c1OC(c1cc(F)ccc1)=O |
| InChI | InChI=1S/C22H14Br2ClFN2O4/c23-15-8-14(11-27-28-20(29)12-31-19-7-2-1-6-18(19)25)21(17(24)10-15)32-22(30)13-4-3-5-16(26)9-13/h1-11H,12H2,(H,28,29) |
| InChIK | AHQCBXFAILRLMU-UHFFFAOYSA-N |
| TotalMolweight | 584.622 |
| Molweight | 584.622 |
| MonoisotopicMass | 581.899285 |
| CLogP | 6.3642 |
| CLogS | -7.689 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 357.29 |
| Relative PSA | 0.19326 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 0.89063 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - [2,4-dibromo-6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate | 2 - [2,4-dibromo-6-[(Z)-[[2-(2-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate