| MolName | 12,13-diphenyl-5-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| MolecularFormula | C34H23N5O2S |
| Smiles | O=C(c(sc1nnc(-c2ccccc2)c(-c2ccccc2)c11)c1N=C1)N1/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H23N5O2S/c40-34-32-31(35-22-39(34)36-20-23-16-18-27(19-17-23)41-21-24-10-4-1-5-11-24)29-28(25-12-6-2-7-13-25)30(37-38-33(29)42-32)26-14-8-3-9-15-26/h1-20,22H,21H2 |
| InChIK | AHVMMFGJNSPOOP-UHFFFAOYSA-N |
| TotalMolweight | 565.656 |
| Molweight | 565.656 |
| MonoisotopicMass | 565.157245 |
| CLogP | 6.5173 |
| CLogS | -9.834 |
| H Acceptors | 7 |
| TotalSurfaceArea | 428.19 |
| Relative PSA | 0.21465 |
| PolarSurfaceArea | 108.28 |
| Druglikeness | 5.2707 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.54762 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 33 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 12,13-diphenyl-5-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one | 2 - 12,13-diphenyl-5-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]-8-thia-3,5,10,11-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one