| MolName | 4-amino-N-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide |
| MolecularFormula | C17H12N6O5Cl2 |
| Smiles | Nc1nonc1C(N/N=C\c(cc(cc1)[N+]([O-])=O)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C17H12Cl2N6O5/c18-11-2-1-9(13(19)6-11)8-29-14-4-3-12(25(27)28)5-10(14)7-21-22-17(26)15-16(20)24-30-23-15/h1-7H,8H2,(H2,20,24)(H,22,26) |
| InChIK | AHXSLEOLORMBLA-UHFFFAOYSA-N |
| TotalMolweight | 451.225 |
| Molweight | 451.225 |
| MonoisotopicMass | 450.024623 |
| CLogP | 3.0795 |
| CLogS | -5.862 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 320.75 |
| Relative PSA | 0.39829 |
| PolarSurfaceArea | 161.45 |
| Druglikeness | 0.93335 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide | 2 - 4-amino-N-[(Z)-[2-[(2,4-dichlorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-1,2,5-oxadiazole-3-carboxamide