| MolName | N-[(Z)-(4-bromophenyl)methylideneamino]-7-chloroquinolin-4-amine |
| MolecularFormula | C16H11N3BrCl |
| Smiles | Clc1ccc(c(N/N=C\c(cc2)ccc2Br)ccn2)c2c1 |
| InChI | InChI=1S/C16H11BrClN3/c17-12-3-1-11(2-4-12)10-20-21-15-7-8-19-16-9-13(18)5-6-14(15)16/h1-10H,(H,19,21) |
| InChIK | AIFWTMNQUGHJCM-UHFFFAOYSA-N |
| TotalMolweight | 360.641 |
| Molweight | 360.641 |
| MonoisotopicMass | 358.982485 |
| CLogP | 6.4881 |
| CLogS | -5.425 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 236.65 |
| Relative PSA | 0.14342 |
| PolarSurfaceArea | 37.28 |
| Druglikeness | 0.59454 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-bromophenyl)methylideneamino]-7-chloroquinolin-4-amine | 2 - N-[(Z)-(4-bromophenyl)methylideneamino]-7-chloroquinolin-4-amine