| MolName | 4-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]benzenesulfonate |
| MolecularFormula | C11H8N3O6S |
| Smiles | [O-][N+](c1ccc(/C=N\Nc(cc2)ccc2S([O-])(=O)=O)o1)=O |
| InChI | InChI=1S/C11H9N3O6S/c15-14(16)11-6-3-9(20-11)7-12-13-8-1-4-10(5-2-8)21(17,18)19/h1-7,13H,(H,17,18,19)/p-1 |
| InChIK | AIGSETDVXLDSNU-UHFFFAOYSA-M |
| TotalMolweight | 310.266 |
| Molweight | 310.266 |
| MonoisotopicMass | 310.013382 |
| CLogP | -0.0175 |
| CLogS | -2.422 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 218.71 |
| Relative PSA | 0.5046 |
| PolarSurfaceArea | 148.93 |
| Druglikeness | -11.475 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]benzenesulfonate | 2 - 4-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]benzenesulfonate