| MolName | 3-[4-(difluoromethoxy)phenyl]-4-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C18H14N4O3F2S |
| Smiles | FC(Oc(cc1)ccc1C(N1/N=C\c(cc2)cc3c2OCCO3)=NNC1=S)F |
| InChI | InChI=1S/C18H14F2N4O3S/c19-17(20)27-13-4-2-12(3-5-13)16-22-23-18(28)24(16)21-10-11-1-6-14-15(9-11)26-8-7-25-14/h1-6,9-10,17H,7-8H2,(H,23,28) |
| InChIK | AIJBZHIFMSYPRV-UHFFFAOYSA-N |
| TotalMolweight | 404.396 |
| Molweight | 404.396 |
| MonoisotopicMass | 404.075467 |
| CLogP | 3.4432 |
| CLogS | -5.255 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 290.94 |
| Relative PSA | 0.33007 |
| PolarSurfaceArea | 99.77 |
| Druglikeness | -6.4697 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-[4-(difluoromethoxy)phenyl]-4-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1H-1,2,4-triazole-5-thione | 2 - 3-[4-(difluoromethoxy)phenyl]-4-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1H-1,2,4-triazole-5-thione