| MolName | [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| MolecularFormula | C29H29N7O4 |
| Smiles | O=C(c1cccc2ccccc12)Oc1ccc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C29H29N7O4/c37-26(25-7-3-5-22-4-1-2-6-24(22)25)40-23-10-8-21(9-11-23)20-30-34-27-31-28(35-12-16-38-17-13-35)33-29(32-27)36-14-18-39-19-15-36/h1-11,20H,12-19H2,(H,31,32,33,34) |
| InChIK | AIKAQAKZFFIWDB-UHFFFAOYSA-N |
| TotalMolweight | 539.594 |
| Molweight | 539.594 |
| MonoisotopicMass | 539.228103 |
| CLogP | 6.2254 |
| CLogS | -6.617 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 411.31 |
| Relative PSA | 0.25776 |
| PolarSurfaceArea | 114.3 |
| Druglikeness | 3.0321 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.525 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate