| MolName | N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| MolecularFormula | C25H17N4O3FS |
| Smiles | [O-][N+](c(cc1)cc2c1sc(C(N/N=C\c1cn(Cc(cccc3)c3F)c3c1cccc3)=O)c2)=O |
| InChI | InChI=1S/C25H17FN4O3S/c26-21-7-3-1-5-16(21)14-29-15-18(20-6-2-4-8-22(20)29)13-27-28-25(31)24-12-17-11-19(30(32)33)9-10-23(17)34-24/h1-13,15H,14H2,(H,28,31) |
| InChIK | AIXIZWNEWDDMMW-UHFFFAOYSA-N |
| TotalMolweight | 472.499 |
| Molweight | 472.499 |
| MonoisotopicMass | 472.100539 |
| CLogP | 4.8317 |
| CLogS | -6.822 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 344.87 |
| Relative PSA | 0.27158 |
| PolarSurfaceArea | 120.45 |
| Druglikeness | 0.77962 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide | 2 - N-[(Z)-[1-[(2-fluorophenyl)methyl]indol-3-yl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide