| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
| MolecularFormula | C15H16N5OF |
| Smiles | Fc1ccc(/C=N\Nc2ncnc(N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C15H16FN5O/c16-13-3-1-12(2-4-13)10-19-20-14-9-15(18-11-17-14)21-5-7-22-8-6-21/h1-4,9-11H,5-8H2,(H,17,18,20) |
| InChIK | AIYOGAHHKKTAAV-UHFFFAOYSA-N |
| TotalMolweight | 301.324 |
| Molweight | 301.324 |
| MonoisotopicMass | 301.133888 |
| CLogP | 3.7503 |
| CLogS | -3.612 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 234.95 |
| Relative PSA | 0.24882 |
| PolarSurfaceArea | 62.64 |
| Druglikeness | 1.9585 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]-6-morpholin-4-ylpyrimidin-4-amine