| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide |
| MolecularFormula | C24H19N4OClS |
| Smiles | O=C(CSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)N/N=C\c(cc1)ccc1Cl |
| InChI | InChI=1S/C24H19ClN4OS/c25-20-13-11-17(12-14-20)15-26-29-21(30)16-31-24-27-22(18-7-3-1-4-8-18)23(28-24)19-9-5-2-6-10-19/h1-15H,16H2,(H,27,28)(H,29,30) |
| InChIK | AJNINWQARFQUPJ-UHFFFAOYSA-N |
| TotalMolweight | 446.961 |
| Molweight | 446.961 |
| MonoisotopicMass | 446.096808 |
| CLogP | 5.9231 |
| CLogS | -7.139 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 341.51 |
| Relative PSA | 0.22974 |
| PolarSurfaceArea | 95.44 |
| Druglikeness | 5.5316 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58065 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]acetamide