| MolName | 4-chloro-3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol |
| MolecularFormula | C18H22N7O3Cl |
| Smiles | Oc(cc1)cc(/C=N\Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1Cl |
| InChI | InChI=1S/C18H22ClN7O3/c19-15-2-1-14(27)11-13(15)12-20-24-16-21-17(25-3-7-28-8-4-25)23-18(22-16)26-5-9-29-10-6-26/h1-2,11-12,27H,3-10H2,(H,21,22,23,24) |
| InChIK | AJSVNINKTFSZMI-UHFFFAOYSA-N |
| TotalMolweight | 419.872 |
| Molweight | 419.872 |
| MonoisotopicMass | 419.147265 |
| CLogP | 3.8608 |
| CLogS | -3.981 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 310.97 |
| Relative PSA | 0.30897 |
| PolarSurfaceArea | 108.23 |
| Druglikeness | 3.2836 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48276 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol | 2 - 4-chloro-3-[(Z)-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazinylidene]methyl]phenol