| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide |
| MolecularFormula | C24H25N3O4S |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C24H25N3O4S/c28-23(26-25-16-22-10-11-24(32-22)27-12-14-29-15-13-27)18-31-21-8-6-20(7-9-21)30-17-19-4-2-1-3-5-19/h1-11,16H,12-15,17-18H2,(H,26,28) |
| InChIK | AJTALFCSVWBUEU-UHFFFAOYSA-N |
| TotalMolweight | 451.546 |
| Molweight | 451.546 |
| MonoisotopicMass | 451.156577 |
| CLogP | 3.8498 |
| CLogS | -5.105 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 352.05 |
| Relative PSA | 0.25542 |
| PolarSurfaceArea | 100.63 |
| Druglikeness | 6.4285 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 9 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]-2-(4-phenylmethoxyphenoxy)acetamide