| MolName | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide |
| MolecularFormula | C16H11N3OCl2S2 |
| Smiles | O=C(CSc1nc(cccc2)c2s1)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C16H11Cl2N3OS2/c17-11-6-5-10(7-12(11)18)8-19-21-15(22)9-23-16-20-13-3-1-2-4-14(13)24-16/h1-8H,9H2,(H,21,22) |
| InChIK | AJTFJXPFGBHQBQ-UHFFFAOYSA-N |
| TotalMolweight | 396.321 |
| Molweight | 396.321 |
| MonoisotopicMass | 394.972056 |
| CLogP | 5.1283 |
| CLogS | -6.571 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 278.38 |
| Relative PSA | 0.30473 |
| PolarSurfaceArea | 107.89 |
| Druglikeness | 4.8128 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide | 2 - 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]acetamide