| MolName | 2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-3-benzylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| MolecularFormula | C31H28N4O3 |
| Smiles | O=C1N(Cc2ccccc2)C(N/N=C\c(cc2)cc3c2OCO3)=NC2=C1C1(CCCC1)Cc1c2cccc1 |
| InChI | InChI=1S/C31H28N4O3/c36-29-27-28(24-11-5-4-10-23(24)17-31(27)14-6-7-15-31)33-30(35(29)19-21-8-2-1-3-9-21)34-32-18-22-12-13-25-26(16-22)38-20-37-25/h1-5,8-13,16,18H,6-7,14-15,17,19-20H2,(H,33,34) |
| InChIK | AJUHZEZLGJDGKS-UHFFFAOYSA-N |
| TotalMolweight | 504.588 |
| Molweight | 504.588 |
| MonoisotopicMass | 504.216141 |
| CLogP | 6.1898 |
| CLogS | -7.572 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 375.67 |
| Relative PSA | 0.18918 |
| PolarSurfaceArea | 75.52 |
| Druglikeness | 3.9401 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.39474 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Amides | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-3-benzylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one | 2 - 2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-3-benzylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one