| MolName | 4-benzamido-N-[(Z)-naphthalen-2-ylmethylideneamino]benzamide |
| MolecularFormula | C25H19N3O2 |
| Smiles | O=C(c1ccccc1)Nc(cc1)ccc1C(N/N=C\c1cc2ccccc2cc1)=O |
| InChI | InChI=1S/C25H19N3O2/c29-24(20-7-2-1-3-8-20)27-23-14-12-21(13-15-23)25(30)28-26-17-18-10-11-19-6-4-5-9-22(19)16-18/h1-17H,(H,27,29)(H,28,30) |
| InChIK | AJVCCVOUJNXDSE-UHFFFAOYSA-N |
| TotalMolweight | 393.445 |
| Molweight | 393.445 |
| MonoisotopicMass | 393.147727 |
| CLogP | 5.5435 |
| CLogS | -6.839 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 310.56 |
| Relative PSA | 0.19484 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 4.8992 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-benzamido-N-[(Z)-naphthalen-2-ylmethylideneamino]benzamide | 2 - 4-benzamido-N-[(Z)-naphthalen-2-ylmethylideneamino]benzamide