| MolName | 2-hydroxy-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide |
| MolecularFormula | C25H20N2O3 |
| Smiles | Oc(cccc1)c1C(N/N=C\c1cc(OCc2cccc3ccccc23)ccc1)=O |
| InChI | InChI=1S/C25H20N2O3/c28-24-14-4-3-13-23(24)25(29)27-26-16-18-7-5-11-21(15-18)30-17-20-10-6-9-19-8-1-2-12-22(19)20/h1-16,28H,17H2,(H,27,29) |
| InChIK | AKLAEZPUKIJRIA-UHFFFAOYSA-N |
| TotalMolweight | 396.445 |
| Molweight | 396.445 |
| MonoisotopicMass | 396.147393 |
| CLogP | 5.3984 |
| CLogS | -6.372 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 311.46 |
| Relative PSA | 0.18978 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.0044 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-hydroxy-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide | 2 - 2-hydroxy-N-[(Z)-[3-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]benzamide