| MolName | [(Z)-(2-chloro-6-fluorophenyl)methylideneamino]urea |
| MolecularFormula | C8H7N3OClF |
| Smiles | NC(N/N=C\c(c(F)ccc1)c1Cl)=O |
| InChI | InChI=1S/C8H7ClFN3O/c9-6-2-1-3-7(10)5(6)4-12-13-8(11)14/h1-4H,(H3,11,13,14) |
| InChIK | AKNOAUAWSLVZHF-UHFFFAOYSA-N |
| TotalMolweight | 215.615 |
| Molweight | 215.615 |
| MonoisotopicMass | 215.026167 |
| CLogP | 1.8421 |
| CLogS | -3.864 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 157.52 |
| Relative PSA | 0.32555 |
| PolarSurfaceArea | 67.48 |
| Druglikeness | 2.9688 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [(Z)-(2-chloro-6-fluorophenyl)methylideneamino]urea | 2 - [(Z)-(2-chloro-6-fluorophenyl)methylideneamino]urea