| MolName | 2-N-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C29H21N7OBr2Cl2 |
| Smiles | Clc1cc(Cl)c(COc(c(Br)cc(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)c2)c2Br)cc1 |
| InChI | InChI=1S/C29H21Br2Cl2N7O/c30-23-13-18(14-24(31)26(23)41-17-19-11-12-20(32)15-25(19)33)16-34-40-29-38-27(35-21-7-3-1-4-8-21)37-28(39-29)36-22-9-5-2-6-10-22/h1-16H,17H2,(H3,35,36,37,38,39,40) |
| InChIK | AKPZBVZSCAQSAI-UHFFFAOYSA-N |
| TotalMolweight | 714.248 |
| Molweight | 714.248 |
| MonoisotopicMass | 710.955134 |
| CLogP | 11.334 |
| CLogS | -10.972 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 459.58 |
| Relative PSA | 0.19322 |
| PolarSurfaceArea | 96.35 |
| Druglikeness | 0.070985 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53659 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Sp3Atoms | 2 |
| Symmetricatoms | 14 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine