| MolName | 4-[(Z)-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C17H12N3O4S |
| Smiles | [O-]C(c1ccc(/C=N\NC(CSc2nc(cccc3)c3o2)=O)cc1)=O |
| InChI | InChI=1S/C17H13N3O4S/c21-15(10-25-17-19-13-3-1-2-4-14(13)24-17)20-18-9-11-5-7-12(8-6-11)16(22)23/h1-9H,10H2,(H,20,21)(H,22,23)/p-1 |
| InChIK | ALFDSGZRVOTTDY-UHFFFAOYSA-M |
| TotalMolweight | 354.365 |
| Molweight | 354.365 |
| MonoisotopicMass | 354.054852 |
| CLogP | 1.0774 |
| CLogS | -4.89 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 266.57 |
| Relative PSA | 0.39727 |
| PolarSurfaceArea | 132.92 |
| Druglikeness | 4.7359 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-(1,3-benzoxazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]benzoate