| MolName | (Z)-N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,1-diphenylmethanimine |
| MolecularFormula | C22H18N2O2 |
| Smiles | C1Oc(ccc(/C=N\N=C(c2ccccc2)c2ccccc2)c2)c2OC1 |
| InChI | InChI=1S/C22H18N2O2/c1-3-7-18(8-4-1)22(19-9-5-2-6-10-19)24-23-16-17-11-12-20-21(15-17)26-14-13-25-20/h1-12,15-16H,13-14H2 |
| InChIK | ALLPYOHWSSPEIG-UHFFFAOYSA-N |
| TotalMolweight | 342.397 |
| Molweight | 342.397 |
| MonoisotopicMass | 342.136828 |
| CLogP | 5.9611 |
| CLogS | -6.09 |
| H Acceptors | 4 |
| TotalSurfaceArea | 274.53 |
| Relative PSA | 0.1567 |
| PolarSurfaceArea | 43.18 |
| Druglikeness | -5.6436 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,1-diphenylmethanimine | 2 - (Z)-N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,1-diphenylmethanimine