| MolName | [4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(naphthalene-1-carbonyloxy)-3-nitrophenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]-2-nitrophenyl] naphthalene-1-carboxylate |
| MolecularFormula | C46H32N6O10 |
| Smiles | [O-][N+](c(cc(/C=N\NC(C(Cc1ccccc1)C(N/N=C\c(cc1)cc([N+]([O-])=O)c1OC(c1cccc2ccccc12)=O)=O)=O)cc1)c1OC(c1cccc2ccccc12)=O)=O |
| InChI | InChI=1S/C46H32N6O10/c53-43(49-47-27-30-20-22-41(39(25-30)51(57)58)61-45(55)36-18-8-14-32-12-4-6-16-34(32)36)38(24-29-10-2-1-3-11-29)44(54)50-48-28-31-21-23-42(40(26-31)52(59)60)62-46(56)37-19-9-15-33-13-5-7-17-35(33)37/h1-23,25-28,38H,24H2,(H,49,53)(H,50 |
| InChIK | ALSJJVIEYZXEAS-UHFFFAOYSA-N |
| TotalMolweight | 828.792 |
| Molweight | 828.792 |
| MonoisotopicMass | 828.217994 |
| CLogP | 8.0596 |
| CLogS | -12.755 |
| H Acceptors | 16 |
| H Donors | 2 |
| TotalSurfaceArea | 618.54 |
| Relative PSA | 0.28929 |
| PolarSurfaceArea | 227.16 |
| Druglikeness | 0.09108 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 62 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 16 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 7 |
| Aromatic Atoms | 38 |
| Sp3Atoms | 6 |
| Symmetricatoms | 29 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(naphthalene-1-carbonyloxy)-3-nitrophenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]-2-nitrophenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[[2-benzyl-3-[(2Z)-2-[[4-(naphthalene-1-carbonyloxy)-3-nitrophenyl]methylidene]hydrazinyl]-3-oxopropanoyl]hydrazinylidene]methyl]-2-nitrophenyl] naphthalene-1-carboxylate