| MolName | N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| MolecularFormula | C16H11N2O3Br |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(o1)ccc1Br)=O |
| InChI | InChI=1S/C16H11BrN2O3/c17-15-6-5-12(22-15)9-18-19-16(21)13-7-10-3-1-2-4-11(10)8-14(13)20/h1-9,20H,(H,19,21) |
| InChIK | AMFQJXXTEUFUEI-UHFFFAOYSA-N |
| TotalMolweight | 359.178 |
| Molweight | 359.178 |
| MonoisotopicMass | 357.995304 |
| CLogP | 4.0616 |
| CLogS | -5.31 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 236.26 |
| Relative PSA | 0.26759 |
| PolarSurfaceArea | 74.83 |
| Druglikeness | 3.1542 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide | 2 - N-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide