| MolName | [1-[(Z)-[(Z)-[2-(4-nitrophenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate |
| MolecularFormula | C34H22N4O10S2 |
| Smiles | [O-][N+](c(cc1)ccc1S(Oc1c(/C=N\N=C/c(c2ccccc2cc2)c2OS(c(cc2)ccc2[N+]([O-])=O)(=O)=O)c2ccccc2cc1)(=O)=O)=O |
| InChI | InChI=1S/C34H22N4O10S2/c39-37(40)25-11-15-27(16-12-25)49(43,44)47-33-19-9-23-5-1-3-7-29(23)31(33)21-35-36-22-32-30-8-4-2-6-24(30)10-20-34(32)48-50(45,46)28-17-13-26(14-18-28)38(41)42/h1-22H |
| InChIK | ANAJGYFMLRTWRW-UHFFFAOYSA-N |
| TotalMolweight | 710.699 |
| Molweight | 710.699 |
| MonoisotopicMass | 710.077736 |
| CLogP | 7.089 |
| CLogS | -9.812 |
| H Acceptors | 14 |
| TotalSurfaceArea | 495.76 |
| Relative PSA | 0.32479 |
| PolarSurfaceArea | 219.86 |
| Druglikeness | -9.8437 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.48 |
| Fragments | 1 |
| Non HAtoms | 50 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 11 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 32 |
| Sp3Atoms | 6 |
| Symmetricatoms | 28 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[(Z)-[2-(4-nitrophenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate | 2 - [1-[(Z)-[(Z)-[2-(4-nitrophenyl)sulfonyloxynaphthalen-1-yl]methylidenehydrazinylidene]methyl]naphthalen-2-yl] 4-nitrobenzenesulfonate