| MolName | [4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
| MolecularFormula | C25H17N2O4F |
| Smiles | Oc1cc2ccccc2cc1C(N/N=C\c(cc1)ccc1OC(c(cccc1)c1F)=O)=O |
| InChI | InChI=1S/C25H17FN2O4/c26-22-8-4-3-7-20(22)25(31)32-19-11-9-16(10-12-19)15-27-28-24(30)21-13-17-5-1-2-6-18(17)14-23(21)29/h1-15,29H,(H,28,30) |
| InChIK | ANRLILFCBPJGIO-UHFFFAOYSA-N |
| TotalMolweight | 428.418 |
| Molweight | 428.418 |
| MonoisotopicMass | 428.117236 |
| CLogP | 5.5816 |
| CLogS | -6.815 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 321.8 |
| Relative PSA | 0.22421 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 2.6578 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 2-fluorobenzoate | 2 - [4-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 2-fluorobenzoate