| MolName | (Z)-1-(4,6-dichloro-2H-thiochromen-3-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C12H8N4Cl2S |
| Smiles | Clc(cc1)cc2c1SCC(/C=N\n1cnnc1)=C2Cl |
| InChI | InChI=1S/C12H8Cl2N4S/c13-9-1-2-11-10(3-9)12(14)8(5-19-11)4-17-18-6-15-16-7-18/h1-4,6-7H,5H2 |
| InChIK | ANYYUQUTCRBPEL-UHFFFAOYSA-N |
| TotalMolweight | 311.196 |
| Molweight | 311.196 |
| MonoisotopicMass | 309.98467 |
| CLogP | 1.835 |
| CLogS | -5.237 |
| H Acceptors | 4 |
| TotalSurfaceArea | 216.01 |
| Relative PSA | 0.26763 |
| PolarSurfaceArea | 68.37 |
| Druglikeness | 4.1378 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | allyl/benzyl chloride; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4,6-dichloro-2H-thiochromen-3-yl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(4,6-dichloro-2H-thiochromen-3-yl)-N-(1,2,4-triazol-4-yl)methanimine