| MolName | N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide |
| MolecularFormula | C22H13N3O2BrCl2F |
| Smiles | N#Cc(cc1)cc(F)c1C(N/N=C\c(cc(cc1)Br)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C22H13BrCl2FN3O2/c23-16-3-6-21(31-12-14-2-4-17(24)9-19(14)25)15(8-16)11-28-29-22(30)18-5-1-13(10-27)7-20(18)26/h1-9,11H,12H2,(H,29,30) |
| InChIK | AOBLBOITLRYUEB-UHFFFAOYSA-N |
| TotalMolweight | 521.172 |
| Molweight | 521.172 |
| MonoisotopicMass | 518.95522 |
| CLogP | 6.4233 |
| CLogS | -8.455 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 348.04 |
| Relative PSA | 0.17116 |
| PolarSurfaceArea | 74.48 |
| Druglikeness | -3.3586 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide | 2 - N-[(Z)-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-cyano-2-fluorobenzamide