| MolName | N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-[4-(tetrazol-1-yl)phenoxy]acetamide |
| MolecularFormula | C14H11N7O4S |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(cc2)ccc2-n2nnnc2)=O)s1)=O |
| InChI | InChI=1S/C14H11N7O4S/c22-13(17-15-7-12-5-6-14(26-12)21(23)24)8-25-11-3-1-10(2-4-11)20-9-16-18-19-20/h1-7,9H,8H2,(H,17,22) |
| InChIK | AOEURURYZYXZAA-UHFFFAOYSA-N |
| TotalMolweight | 373.352 |
| Molweight | 373.352 |
| MonoisotopicMass | 373.059323 |
| CLogP | 0.8097 |
| CLogS | -4.42 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 275.6 |
| Relative PSA | 0.49554 |
| PolarSurfaceArea | 168.35 |
| Druglikeness | -0.80577 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-[4-(tetrazol-1-yl)phenoxy]acetamide | 2 - N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-[4-(tetrazol-1-yl)phenoxy]acetamide