| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-bromo-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| MolecularFormula | C19H14N5O5Br |
| Smiles | [O-][N+](c1ccc(Cn2nc(C(N/N=C\c(cc3)cc4c3OCO4)=O)c(Br)c2)cc1)=O |
| InChI | InChI=1S/C19H14BrN5O5/c20-15-10-24(9-12-1-4-14(5-2-12)25(27)28)23-18(15)19(26)22-21-8-13-3-6-16-17(7-13)30-11-29-16/h1-8,10H,9,11H2,(H,22,26) |
| InChIK | AOIFWUYMWDRCGN-UHFFFAOYSA-N |
| TotalMolweight | 472.254 |
| Molweight | 472.254 |
| MonoisotopicMass | 471.017831 |
| CLogP | 2.5904 |
| CLogS | -5.307 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 311.03 |
| Relative PSA | 0.33524 |
| PolarSurfaceArea | 123.56 |
| Druglikeness | -3.3654 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.63333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-bromo-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4-bromo-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide