| MolName | 6-chloro-N'-[(Z)-furan-2-ylmethylideneamino]pyrazine-2-carboximidamide |
| MolecularFormula | C10H8N5OCl |
| Smiles | N/C(/c1cncc(Cl)n1)=N/N=C\c1ccco1 |
| InChI | InChI=1S/C10H8ClN5O/c11-9-6-13-5-8(15-9)10(12)16-14-4-7-2-1-3-17-7/h1-6H,(H2,12,16) |
| InChIK | AOPULODFIKKRMP-UHFFFAOYSA-N |
| TotalMolweight | 249.661 |
| Molweight | 249.661 |
| MonoisotopicMass | 249.041737 |
| CLogP | 1.8839 |
| CLogS | -2.512 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 191.9 |
| Relative PSA | 0.38739 |
| PolarSurfaceArea | 89.66 |
| Druglikeness | 1.4623 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-chloro-N'-[(Z)-furan-2-ylmethylideneamino]pyrazine-2-carboximidamide | 2 - 6-chloro-N'-[(Z)-furan-2-ylmethylideneamino]pyrazine-2-carboximidamide