| MolName | 2-N-[(Z)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C21H19N7OBrF3 |
| Smiles | FC(c1cccc(Nc2nc(N/N=C\c3cccc(Br)c3)nc(N3CCOCC3)n2)c1)(F)F |
| InChI | InChI=1S/C21H19BrF3N7O/c22-16-5-1-3-14(11-16)13-26-31-19-28-18(29-20(30-19)32-7-9-33-10-8-32)27-17-6-2-4-15(12-17)21(23,24)25/h1-6,11-13H,7-10H2,(H2,27,28,29,30,31) |
| InChIK | APEFYYLUTKIODG-UHFFFAOYSA-N |
| TotalMolweight | 522.328 |
| Molweight | 522.328 |
| MonoisotopicMass | 521.078653 |
| CLogP | 7.0354 |
| CLogS | -6.628 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 346.67 |
| Relative PSA | 0.23333 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | -5.5541 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-(3-bromophenyl)methylideneamino]-6-morpholin-4-yl-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine