| MolName | [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C23H17N3O4BrF |
| Smiles | O=C(CNC(c(cc1)ccc1F)=O)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Br)=O |
| InChI | InChI=1S/C23H17BrFN3O4/c24-20-4-2-1-3-19(20)23(31)32-18-11-5-15(6-12-18)13-27-28-21(29)14-26-22(30)16-7-9-17(25)10-8-16/h1-13H,14H2,(H,26,30)(H,28,29) |
| InChIK | APMQRLNLIAUKCP-UHFFFAOYSA-N |
| TotalMolweight | 498.307 |
| Molweight | 498.307 |
| MonoisotopicMass | 497.038646 |
| CLogP | 4.5418 |
| CLogS | -6.106 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 342.45 |
| Relative PSA | 0.24398 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 1.9231 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [4-[(Z)-[[2-[(4-fluorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate